C15H24O4 — CID 5320341
(4aS,7R)-1,4a-dimethyl-7-(1,2,3-trihydroxypropan-2-yl)-3,4,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 5320341) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (4aS,7R)-1,4a-dimethyl-7-(1,2,3-trihydroxypropan-2-yl)-3,4,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | (4aS,7R)-1,4a-dimethyl-7-(1,2,3-trihydroxypropan-2-yl)-3,4,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 5320341 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (4aS,7R)-1,4a-dimethyl-7-(1,2,3-trihydroxypropan-2-yl)-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | CC1=C2C[C@H](C(O)(CO)CO)CC[C@@]2(C)CCC1=O |
| InChI | InChI=1S/C15H24O4/c1-10-12-7-11(15(19,8-16)9-17)3-5-14(12,2)6-4-13(10)18/h11,16-17,19H,3-9H2,1-2H3/t11-,14+/m1/s1 |
| InChIKey | WYTBKFXLHDEVKL-RISCZKNCSA-N |
| XLogP | 1.19 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |