C25H28N4O2 — CID 53204040
1-(1-benzyl-6-oxopyridazin-4-yl)-N-(2,4-dimethylphenyl)piperidine-3-carboxamide (PubChem CID 53204040) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 1-(1-benzyl-6-oxopyridazin-4-yl)-N-(2,4-dimethylphenyl)piperidine-3-carboxamide.
| Compound Name | 1-(1-benzyl-6-oxopyridazin-4-yl)-N-(2,4-dimethylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53204040 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 1-(1-benzyl-6-oxopyridazin-4-yl)-N-(2,4-dimethylphenyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCCN(c3cnn(Cc4ccccc4)c(=O)c3)C2)c(C)c1 |
| InChI | InChI=1S/C25H28N4O2/c1-18-10-11-23(19(2)13-18)27-25(31)21-9-6-12-28(17-21)22-14-24(30)29(26-15-22)16-20-7-4-3-5-8-20/h3-5,7-8,10-11,13-15,21H,6,9,12,16-17H2,1-2H3,(H,27,31) |
| InChIKey | BMOZUFWPNIEEQX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |