C13H19N5O3 — CID 53204590
1-(5-ethoxy-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-3-(3-methoxypropyl)urea (PubChem CID 53204590) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is 1-(5-ethoxy-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-3-(3-methoxypropyl)urea.
| Compound Name | 1-(5-ethoxy-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-3-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 53204590 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 1-(5-ethoxy-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-3-(3-methoxypropyl)urea |
| SMILES | CCOc1cccc2nnc(NC(=O)NCCCOC)n12 |
| InChI | InChI=1S/C13H19N5O3/c1-3-21-11-7-4-6-10-16-17-12(18(10)11)15-13(19)14-8-5-9-20-2/h4,6-7H,3,5,8-9H2,1-2H3,(H2,14,15,17,19) |
| InChIKey | MJHYRJHWZYKVAM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|