C25H20ClFN2O4 — CID 53207321
3-[(1,3-benzodioxol-5-ylmethylamino)methyl]-1-[(2-chloro-4-fluorophenyl)methyl]indole-2-carboxylic acid (PubChem CID 53207321) has the molecular formula C25H20ClFN2O4 and a molecular weight of 466.90 g/mol. Its IUPAC name is 3-[(1,3-benzodioxol-5-ylmethylamino)methyl]-1-[(2-chloro-4-fluorophenyl)methyl]indole-2-carboxylic acid.
| Compound Name | 3-[(1,3-benzodioxol-5-ylmethylamino)methyl]-1-[(2-chloro-4-fluorophenyl)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53207321 |
| Molecular Formula | C25H20ClFN2O4 |
| Molecular Weight | 466.90 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 3-[(1,3-benzodioxol-5-ylmethylamino)methyl]-1-[(2-chloro-4-fluorophenyl)methyl]indole-2-carboxylic acid |
| SMILES | O=C(O)c1c(CNCc2ccc3c(c2)OCO3)c2ccccc2n1Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C25H20ClFN2O4/c26-20-10-17(27)7-6-16(20)13-29-21-4-2-1-3-18(21)19(24(29)25(30)31)12-28-11-15-5-8-22-23(9-15)33-14-32-22/h1-10,28H,11-14H2,(H,30,31) |
| InChIKey | YJFHNKAPLPUGAJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.90 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|