C21H22N2O4 — CID 53208807
3-[(1,3-benzodioxol-5-ylmethylamino)methyl]-1-ethyl-6-methylindole-2-carboxylic acid (PubChem CID 53208807) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 3-[(1,3-benzodioxol-5-ylmethylamino)methyl]-1-ethyl-6-methylindole-2-carboxylic acid.
| Compound Name | 3-[(1,3-benzodioxol-5-ylmethylamino)methyl]-1-ethyl-6-methylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 53208807 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 3-[(1,3-benzodioxol-5-ylmethylamino)methyl]-1-ethyl-6-methylindole-2-carboxylic acid |
| SMILES | CCn1c(C(=O)O)c(CNCc2ccc3c(c2)OCO3)c2ccc(C)cc21 |
| InChI | InChI=1S/C21H22N2O4/c1-3-23-17-8-13(2)4-6-15(17)16(20(23)21(24)25)11-22-10-14-5-7-18-19(9-14)27-12-26-18/h4-9,22H,3,10-12H2,1-2H3,(H,24,25) |
| InChIKey | NHSWFMRPFRBQBN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|