C20H22N2O4 — CID 53208750
3-[[(4-ethoxyphenyl)methylamino]methyl]-6-methoxy-1H-indole-2-carboxylic acid (PubChem CID 53208750) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-[[(4-ethoxyphenyl)methylamino]methyl]-6-methoxy-1H-indole-2-carboxylic acid.
| Compound Name | 3-[[(4-ethoxyphenyl)methylamino]methyl]-6-methoxy-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53208750 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 3-[[(4-ethoxyphenyl)methylamino]methyl]-6-methoxy-1H-indole-2-carboxylic acid |
| SMILES | CCOc1ccc(CNCc2c(C(=O)O)[nH]c3cc(OC)ccc23)cc1 |
| InChI | InChI=1S/C20H22N2O4/c1-3-26-14-6-4-13(5-7-14)11-21-12-17-16-9-8-15(25-2)10-18(16)22-19(17)20(23)24/h4-10,21-22H,3,11-12H2,1-2H3,(H,23,24) |
| InChIKey | NMZUUGGZIUNOLS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|