C28H30N2O2 — CID 53208871
6-methyl-1-[(4-methylphenyl)methyl]-3-[(2-phenylpropylamino)methyl]indole-2-carboxylic acid (PubChem CID 53208871) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 6-methyl-1-[(4-methylphenyl)methyl]-3-[(2-phenylpropylamino)methyl]indole-2-carboxylic acid.
| Compound Name | 6-methyl-1-[(4-methylphenyl)methyl]-3-[(2-phenylpropylamino)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53208871 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 6-methyl-1-[(4-methylphenyl)methyl]-3-[(2-phenylpropylamino)methyl]indole-2-carboxylic acid |
| SMILES | Cc1ccc(Cn2c(C(=O)O)c(CNCC(C)c3ccccc3)c3ccc(C)cc32)cc1 |
| InChI | InChI=1S/C28H30N2O2/c1-19-9-12-22(13-10-19)18-30-26-15-20(2)11-14-24(26)25(27(30)28(31)32)17-29-16-21(3)23-7-5-4-6-8-23/h4-15,21,29H,16-18H2,1-3H3,(H,31,32) |
| InChIKey | GPFOCSPAIMBAHE-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|