About 5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride
5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride (PubChem CID 53212015) has the molecular formula C8H6ClNO3S2
and a molecular weight of 263.73 g/mol. Its IUPAC name is 5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride.
Analyze 5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride?
The IUPAC name of 5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride (CID 53212015) is 5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride.
What is the SMILES notation for 5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride?
The canonical SMILES for 5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride is Cc1cc(-c2ccc(S(=O)(=O)Cl)s2)on1.
What is the InChIKey of 5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride?
The InChIKey is KYTGBJPEUYAGNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNO3S2/c1-5-4-6(13-10-5)7-2-3-8(14-7)15(9,11)12/h2-4H,1H3.
What are the key properties of 5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride?
5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride has a molecular weight of 263.73 g/mol, XLogP of 2.64, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride is sourced from PubChem (CID 53212015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).