4-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-4-oxobutanoic acid

C14H17NO3S — CID 53212909

IUPAC4-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-4-oxobutanoic acid
SMILESCC1(C)CN(C(=O)CCC(=O)O)c2ccccc2S1
InChIInChI=1S/C14H17NO3S/c1-14(2)9-15(12(16)7-8-13(17)18)10-5-3-4-6-11(10)19-14/h3-6H,7-9H2,1-2H3,(H,17,18)
InChIKeyKMDIAEBDIRLMIF-UHFFFAOYSA-N
MW279.36 g/mol
LogP2.77
Rot. Bonds3

About 4-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-4-oxobutanoic acid

4-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-4-oxobutanoic acid (PubChem CID 53212909) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is 4-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-4-oxobutanoic acid
PubChem CID53212909
Molecular FormulaC14H17NO3S
Molecular Weight279.36 g/mol
Exact Mass279.09
IUPAC Name4-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-4-oxobutanoic acid
SMILESCC1(C)CN(C(=O)CCC(=O)O)c2ccccc2S1
InChIInChI=1S/C14H17NO3S/c1-14(2)9-15(12(16)7-8-13(17)18)10-5-3-4-6-11(10)19-14/h3-6H,7-9H2,1-2H3,(H,17,18)
InChIKeyKMDIAEBDIRLMIF-UHFFFAOYSA-N
XLogP2.77
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.36
LogP ≤ 52.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-4-oxobutanoic acid?
The IUPAC name of 4-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-4-oxobutanoic acid (CID 53212909) is 4-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-4-oxobutanoic acid.
What is the SMILES notation for 4-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-4-oxobutanoic acid?
The canonical SMILES for 4-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-4-oxobutanoic acid is CC1(C)CN(C(=O)CCC(=O)O)c2ccccc2S1.
What is the InChIKey of 4-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-4-oxobutanoic acid?
The InChIKey is KMDIAEBDIRLMIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3S/c1-14(2)9-15(12(16)7-8-13(17)18)10-5-3-4-6-11(10)19-14/h3-6H,7-9H2,1-2H3,(H,17,18).
What are the key properties of 4-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-4-oxobutanoic acid?
4-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-4-oxobutanoic acid has a molecular weight of 279.36 g/mol, XLogP of 2.77, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-4-oxobutanoic acid is sourced from PubChem (CID 53212909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).