About (2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(5-nitro-2-pyridinyl)methanone
(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(5-nitro-2-pyridinyl)methanone (PubChem CID 71917360) has the molecular formula C16H15N3O3S
and a molecular weight of 329.38 g/mol. Its IUPAC name is (2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(5-nitro-2-pyridinyl)methanone.
Molecular Properties
| Compound Name | (2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(5-nitro-2-pyridinyl)methanone |
| PubChem CID | 71917360 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | (2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(5-nitro-2-pyridinyl)methanone |
| SMILES | CC1(C)CN(C(=O)c2ccc([N+](=O)[O-])cn2)c2ccccc2S1 |
| InChI | InChI=1S/C16H15N3O3S/c1-16(2)10-18(13-5-3-4-6-14(13)23-16)15(20)12-8-7-11(9-17-12)19(21)22/h3-9H,10H2,1-2H3 |
| InChIKey | MBPGDBKCMXDROD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(5-nitro-2-pyridinyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(5-nitro-2-pyridinyl)methanone?
The IUPAC name of (2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(5-nitro-2-pyridinyl)methanone (CID 71917360) is (2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(5-nitro-2-pyridinyl)methanone.
What is the SMILES notation for (2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(5-nitro-2-pyridinyl)methanone?
The canonical SMILES for (2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(5-nitro-2-pyridinyl)methanone is CC1(C)CN(C(=O)c2ccc([N+](=O)[O-])cn2)c2ccccc2S1.
What is the InChIKey of (2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(5-nitro-2-pyridinyl)methanone?
The InChIKey is MBPGDBKCMXDROD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O3S/c1-16(2)10-18(13-5-3-4-6-14(13)23-16)15(20)12-8-7-11(9-17-12)19(21)22/h3-9H,10H2,1-2H3.
What are the key properties of (2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(5-nitro-2-pyridinyl)methanone?
(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(5-nitro-2-pyridinyl)methanone has a molecular weight of 329.38 g/mol, XLogP of 3.52, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-3H-1,4-benzothiazin-4-yl)-(5-nitro-2-pyridinyl)methanone is sourced from PubChem (CID 71917360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).