C15H11ClN2O3S — CID 55342446
(2-chloro-4-nitrophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone (PubChem CID 55342446) has the molecular formula C15H11ClN2O3S and a molecular weight of 334.78 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone.
| Compound Name | (2-chloro-4-nitrophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone |
|---|---|
| PubChem CID | 55342446 |
| Molecular Formula | C15H11ClN2O3S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | (2-chloro-4-nitrophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1Cl)N1CCSc2ccccc21 |
| InChI | InChI=1S/C15H11ClN2O3S/c16-12-9-10(18(20)21)5-6-11(12)15(19)17-7-8-22-14-4-2-1-3-13(14)17/h1-6,9H,7-8H2 |
| InChIKey | XZGYLJIHWKDAEF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|