C13H13NO3 — CID 53217947
5-(2,5-dimethoxyphenyl)pyridin-3-ol (PubChem CID 53217947) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-(2,5-dimethoxyphenyl)pyridin-3-ol.
| Compound Name | 5-(2,5-dimethoxyphenyl)pyridin-3-ol |
|---|---|
| PubChem CID | 53217947 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 5-(2,5-dimethoxyphenyl)pyridin-3-ol |
| SMILES | COc1ccc(OC)c(-c2cncc(O)c2)c1 |
| InChI | InChI=1S/C13H13NO3/c1-16-11-3-4-13(17-2)12(6-11)9-5-10(15)8-14-7-9/h3-8,15H,1-2H3 |
| InChIKey | CKKWKCMRLUYCDZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |