2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid

C10H14O2 — CID 5321816

IUPAC2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid
SMILESCC1(C(=O)O)C2CC3C(C2)C31C
InChIInChI=1S/C10H14O2/c1-9(8(11)12)5-3-6-7(4-5)10(6,9)2/h5-7H,3-4H2,1-2H3,(H,11,12)
InChIKeyQHDPITNBVDSMQH-UHFFFAOYSA-N
MW166.22 g/mol
LogP1.75
Rot. Bonds1

About 2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid

2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid (PubChem CID 5321816) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid.

Molecular Properties

Compound Name2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid
PubChem CID5321816
Molecular FormulaC10H14O2
Molecular Weight166.22 g/mol
Exact Mass166.10
IUPAC Name2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid
SMILESCC1(C(=O)O)C2CC3C(C2)C31C
InChIInChI=1S/C10H14O2/c1-9(8(11)12)5-3-6-7(4-5)10(6,9)2/h5-7H,3-4H2,1-2H3,(H,11,12)
InChIKeyQHDPITNBVDSMQH-UHFFFAOYSA-N
XLogP1.75
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.22
LogP ≤ 51.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Bicyclo(2.2.1)heptane-2-carboxylic acid, 3,3-dimethyl-
CID 99843
Norecasantalic acid
CID 100966488
Tricyclo[2.2.1.0,2,6]heptane-1-carboxylic acid
CID 296927
Tricyclo[2.2.1.02,6]heptane-3-carboxylic acid
CID 296845
2-Methylbicyclo(2.2.1)heptane-2-carboxylic acid
CID 122552
Tricyclo(5.2.1.0,2,6)decane-2-carboxylic acid
CID 574763
Tetracyclo(3.2.0.0^(2,7).0^(4,6))heptane-1-carboxylic acid
CID 13981154
Dihydro-alpha-santalic acid
CID 14467331
3-(2,3-Dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)propanoic acid
CID 15433329
2-Bornanecarboxylic acid
CID 565594
(1,7,7-Trimethylbicyclo[2.2.1]heptan-2-yl)acetic acid
CID 20327362
DL-Camphoricacid
CID 297894

Frequently Asked Questions

What is the IUPAC name of 2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid?
The IUPAC name of 2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid (CID 5321816) is 2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid.
What is the SMILES notation for 2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid?
The canonical SMILES for 2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid is CC1(C(=O)O)C2CC3C(C2)C31C.
What is the InChIKey of 2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid?
The InChIKey is QHDPITNBVDSMQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-9(8(11)12)5-3-6-7(4-5)10(6,9)2/h5-7H,3-4H2,1-2H3,(H,11,12).
What are the key properties of 2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid?
2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid has a molecular weight of 166.22 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyltricyclo[2.2.1.02,6]heptane-3-carboxylic acid is sourced from PubChem (CID 5321816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).