C16H14ClNO2 — CID 53221507
3-(3-chloro-5-hydroxyphenyl)-N-cyclopropylbenzamide (PubChem CID 53221507) has the molecular formula C16H14ClNO2 and a molecular weight of 287.75 g/mol. Its IUPAC name is 3-(3-chloro-5-hydroxyphenyl)-N-cyclopropylbenzamide.
| Compound Name | 3-(3-chloro-5-hydroxyphenyl)-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 53221507 |
| Molecular Formula | C16H14ClNO2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 3-(3-chloro-5-hydroxyphenyl)-N-cyclopropylbenzamide |
| SMILES | O=C(NC1CC1)c1cccc(-c2cc(O)cc(Cl)c2)c1 |
| InChI | InChI=1S/C16H14ClNO2/c17-13-7-12(8-15(19)9-13)10-2-1-3-11(6-10)16(20)18-14-4-5-14/h1-3,6-9,14,19H,4-5H2,(H,18,20) |
| InChIKey | SIZFXTCIMPIFKK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |