C17H15FO5 — CID 53228416
4-(4-ethoxycarbonyl-3-fluorophenyl)-3-methoxybenzoic acid (PubChem CID 53228416) has the molecular formula C17H15FO5 and a molecular weight of 318.30 g/mol. Its IUPAC name is 4-(4-ethoxycarbonyl-3-fluorophenyl)-3-methoxybenzoic acid.
| Compound Name | 4-(4-ethoxycarbonyl-3-fluorophenyl)-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 53228416 |
| Molecular Formula | C17H15FO5 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4-(4-ethoxycarbonyl-3-fluorophenyl)-3-methoxybenzoic acid |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C(=O)O)cc2OC)cc1F |
| InChI | InChI=1S/C17H15FO5/c1-3-23-17(21)13-7-4-10(8-14(13)18)12-6-5-11(16(19)20)9-15(12)22-2/h4-9H,3H2,1-2H3,(H,19,20) |
| InChIKey | XUIPBMDKSHXIEA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |