C15H11F3O4 — CID 53228622
3-hydroxy-4-[4-methoxy-3-(trifluoromethyl)phenyl]benzoic acid (PubChem CID 53228622) has the molecular formula C15H11F3O4 and a molecular weight of 312.24 g/mol. Its IUPAC name is 3-hydroxy-4-[4-methoxy-3-(trifluoromethyl)phenyl]benzoic acid.
| Compound Name | 3-hydroxy-4-[4-methoxy-3-(trifluoromethyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 53228622 |
| Molecular Formula | C15H11F3O4 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 3-hydroxy-4-[4-methoxy-3-(trifluoromethyl)phenyl]benzoic acid |
| SMILES | COc1ccc(-c2ccc(C(=O)O)cc2O)cc1C(F)(F)F |
| InChI | InChI=1S/C15H11F3O4/c1-22-13-5-3-8(6-11(13)15(16,17)18)10-4-2-9(14(20)21)7-12(10)19/h2-7,19H,1H3,(H,20,21) |
| InChIKey | SDCWJJOAIPTKQX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |