C21H14ClF3O3 — CID 143502040
3-chloro-4-[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]benzoic acid (PubChem CID 143502040) has the molecular formula C21H14ClF3O3 and a molecular weight of 406.79 g/mol. Its IUPAC name is 3-chloro-4-[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]benzoic acid.
| Compound Name | 3-chloro-4-[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 143502040 |
| Molecular Formula | C21H14ClF3O3 |
| Molecular Weight | 406.79 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 3-chloro-4-[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]benzoic acid |
| SMILES | COc1ccc(-c2ccc(C(=O)O)cc2Cl)cc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H14ClF3O3/c1-28-19-9-5-13(16-8-4-14(20(26)27)11-18(16)22)10-17(19)12-2-6-15(7-3-12)21(23,24)25/h2-11H,1H3,(H,26,27) |
| InChIKey | QCCRHLDIRRHQFH-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.79 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |