C20H26N2O3S2 — CID 5322909
N-(4-ethylphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide (PubChem CID 5322909) has the molecular formula C20H26N2O3S2 and a molecular weight of 406.57 g/mol. Its IUPAC name is N-(4-ethylphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide.
| Compound Name | N-(4-ethylphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 5322909 |
| Molecular Formula | C20H26N2O3S2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-(4-ethylphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide |
| SMILES | CCc1ccc(NC(=O)C2CCC(CNS(=O)(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C20H26N2O3S2/c1-2-15-7-11-18(12-8-15)22-20(23)17-9-5-16(6-10-17)14-21-27(24,25)19-4-3-13-26-19/h3-4,7-8,11-13,16-17,21H,2,5-6,9-10,14H2,1H3,(H,22,23) |
| InChIKey | WKQUCHVYUYXFCT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |