C20H20BClN4O2 — CID 53231095
2-[5-chloro-3-(4,6-dimethylpyrimidin-2-yl)-2-(1,3,2-dioxaborolan-2-yl)phenyl]-4,6-dimethylpyrimidine (PubChem CID 53231095) has the molecular formula C20H20BClN4O2 and a molecular weight of 394.67 g/mol. Its IUPAC name is 2-[5-chloro-3-(4,6-dimethylpyrimidin-2-yl)-2-(1,3,2-dioxaborolan-2-yl)phenyl]-4,6-dimethylpyrimidine.
| Compound Name | 2-[5-chloro-3-(4,6-dimethylpyrimidin-2-yl)-2-(1,3,2-dioxaborolan-2-yl)phenyl]-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 53231095 |
| Molecular Formula | C20H20BClN4O2 |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2-[5-chloro-3-(4,6-dimethylpyrimidin-2-yl)-2-(1,3,2-dioxaborolan-2-yl)phenyl]-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(-c2cc(Cl)cc(-c3nc(C)cc(C)n3)c2B2OCCO2)n1 |
| InChI | InChI=1S/C20H20BClN4O2/c1-11-7-12(2)24-19(23-11)16-9-15(22)10-17(18(16)21-27-5-6-28-21)20-25-13(3)8-14(4)26-20/h7-10H,5-6H2,1-4H3 |
| InChIKey | DWFNFVRGUJTENC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|