C13H20O5 — CID 53231104
diethyl 2-[(2E,4R)-4-hydroxyhexa-2,5-dienyl]propanedioate (PubChem CID 53231104) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is diethyl 2-[(2E,4R)-4-hydroxyhexa-2,5-dienyl]propanedioate.
| Compound Name | diethyl 2-[(2E,4R)-4-hydroxyhexa-2,5-dienyl]propanedioate |
|---|---|
| PubChem CID | 53231104 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | diethyl 2-[(2E,4R)-4-hydroxyhexa-2,5-dienyl]propanedioate |
| SMILES | C=C[C@@H](O)/C=C/CC(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C13H20O5/c1-4-10(14)8-7-9-11(12(15)17-5-2)13(16)18-6-3/h4,7-8,10-11,14H,1,5-6,9H2,2-3H3/b8-7+/t10-/m1/s1 |
| InChIKey | DKORKZIRFBNBJQ-QROSGCPLSA-N |
| XLogP | 1.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|