C25H42N2O4S — CID 53233591
(1R,4aS)-N-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamothioyl]-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,6,7,8,9,10,10a-decahydrophenanthrene-1-carboxamide (PubChem CID 53233591) has the molecular formula C25H42N2O4S and a molecular weight of 466.69 g/mol. Its IUPAC name is (1R,4aS)-N-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamothioyl]-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,6,7,8,9,10,10a-decahydrophenanthrene-1-carboxamide.
| Compound Name | (1R,4aS)-N-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamothioyl]-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,6,7,8,9,10,10a-decahydrophenanthrene-1-carboxamide |
|---|---|
| PubChem CID | 53233591 |
| Molecular Formula | C25H42N2O4S |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | (1R,4aS)-N-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]carbamothioyl]-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,6,7,8,9,10,10a-decahydrophenanthrene-1-carboxamide |
| SMILES | CC(C)C1CCC2=C(CCC3[C@](C)(C(=O)NC(=S)NC(CO)(CO)CO)CCC[C@]23C)C1 |
| InChI | InChI=1S/C25H42N2O4S/c1-16(2)17-6-8-19-18(12-17)7-9-20-23(19,3)10-5-11-24(20,4)21(31)26-22(32)27-25(13-28,14-29)15-30/h16-17,20,28-30H,5-15H2,1-4H3,(H2,26,27,31,32)/t17?,20?,23-,24-/m1/s1 |
| InChIKey | XTIQMAFJPSNZTI-SKIMOMLXSA-N |
| XLogP | 3.05 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|