C29H35N5O4S — CID 53234653
7-[3-[[(1R,4S)-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl]methyl]cyclobutyl]-5-[2-(oxolan-2-yl)-3,4-dihydro-2H-chromen-7-yl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 53234653) has the molecular formula C29H35N5O4S and a molecular weight of 549.70 g/mol. Its IUPAC name is 7-[3-[[(1R,4S)-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl]methyl]cyclobutyl]-5-[2-(oxolan-2-yl)-3,4-dihydro-2H-chromen-7-yl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[3-[[(1R,4S)-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl]methyl]cyclobutyl]-5-[2-(oxolan-2-yl)-3,4-dihydro-2H-chromen-7-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 53234653 |
| Molecular Formula | C29H35N5O4S |
| Molecular Weight | 549.70 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | 7-[3-[[(1R,4S)-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl]methyl]cyclobutyl]-5-[2-(oxolan-2-yl)-3,4-dihydro-2H-chromen-7-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1c(-c1ccc3c(c1)OC(C1CCCO1)CC3)cn2C1CC(CN2C[C@H]3C[C@H]2CS3(=O)=O)C1 |
| InChI | InChI=1S/C29H35N5O4S/c30-28-27-23(19-4-3-18-5-6-25(38-26(18)10-19)24-2-1-7-37-24)14-34(29(27)32-16-31-28)20-8-17(9-20)12-33-13-22-11-21(33)15-39(22,35)36/h3-4,10,14,16-17,20-22,24-25H,1-2,5-9,11-13,15H2,(H2,30,31,32)/t17?,20?,21-,22+,24?,25?/m0/s1 |
| InChIKey | NYNQNXWPKDGUHX-WJVDORCOSA-N |
| XLogP | 3.38 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.70 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |