C21H23N5O3 — CID 155548146
5-(1,3-benzodioxol-5-yl)-7-[(3S,5R)-5-methyl-1-[[(2R)-oxiran-2-yl]methyl]pyrrolidin-3-yl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 155548146) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-7-[(3S,5R)-5-methyl-1-[[(2R)-oxiran-2-yl]methyl]pyrrolidin-3-yl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-7-[(3S,5R)-5-methyl-1-[[(2R)-oxiran-2-yl]methyl]pyrrolidin-3-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155548146 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-7-[(3S,5R)-5-methyl-1-[[(2R)-oxiran-2-yl]methyl]pyrrolidin-3-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C[C@@H]1C[C@H](n2cc(-c3ccc4c(c3)OCO4)c3c(N)ncnc32)CN1C[C@@H]1CO1 |
| InChI | InChI=1S/C21H23N5O3/c1-12-4-14(6-25(12)7-15-9-27-15)26-8-16(19-20(22)23-10-24-21(19)26)13-2-3-17-18(5-13)29-11-28-17/h2-3,5,8,10,12,14-15H,4,6-7,9,11H2,1H3,(H2,22,23,24)/t12-,14+,15-/m1/s1 |
| InChIKey | ALLGXBSMTHXWHK-VHDGCEQUSA-N |
| XLogP | 2.44 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|