C22H19F3N2O4S — CID 53235176
quinolin-2-yl-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-1-yl]methanone (PubChem CID 53235176) has the molecular formula C22H19F3N2O4S and a molecular weight of 464.47 g/mol. Its IUPAC name is quinolin-2-yl-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-1-yl]methanone.
| Compound Name | quinolin-2-yl-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 53235176 |
| Molecular Formula | C22H19F3N2O4S |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | quinolin-2-yl-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-1-yl]methanone |
| SMILES | O=C(c1ccc2ccccc2n1)N1CCC(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H19F3N2O4S/c23-22(24,25)31-16-6-8-17(9-7-16)32(29,30)18-11-13-27(14-12-18)21(28)20-10-5-15-3-1-2-4-19(15)26-20/h1-10,18H,11-14H2 |
| InChIKey | BPCZMGUGWMJXFK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |