C28H39N3O3 — CID 53236372
(13S)-3'-[2-(azepan-1-yl)ethyl]-3-hydroxy-13-methylspiro[7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17,5'-imidazolidine]-2',4'-dione (PubChem CID 53236372) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is (13S)-3'-[2-(azepan-1-yl)ethyl]-3-hydroxy-13-methylspiro[7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17,5'-imidazolidine]-2',4'-dione.
| Compound Name | (13S)-3'-[2-(azepan-1-yl)ethyl]-3-hydroxy-13-methylspiro[7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 53236372 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | (13S)-3'-[2-(azepan-1-yl)ethyl]-3-hydroxy-13-methylspiro[7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17,5'-imidazolidine]-2',4'-dione |
| SMILES | C[C@]12CCC3c4ccc(O)cc4CCC3C1CCC21NC(=O)N(CCN2CCCCCC2)C1=O |
| InChI | InChI=1S/C28H39N3O3/c1-27-12-10-22-21-9-7-20(32)18-19(21)6-8-23(22)24(27)11-13-28(27)25(33)31(26(34)29-28)17-16-30-14-4-2-3-5-15-30/h7,9,18,22-24,32H,2-6,8,10-17H2,1H3,(H,29,34)/t22?,23?,24?,27-,28?/m0/s1 |
| InChIKey | JJNSRLMTEGVQPY-KQLLPRIFSA-N |
| XLogP | 4.41 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|