C17H22N2O2 — CID 53243649
(4R,5S)-2,5-dimethyl-4-(4-morpholin-4-ylanilino)cyclopent-2-en-1-one (PubChem CID 53243649) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is (4R,5S)-2,5-dimethyl-4-(4-morpholin-4-ylanilino)cyclopent-2-en-1-one.
| Compound Name | (4R,5S)-2,5-dimethyl-4-(4-morpholin-4-ylanilino)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 53243649 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (4R,5S)-2,5-dimethyl-4-(4-morpholin-4-ylanilino)cyclopent-2-en-1-one |
| SMILES | CC1=C[C@@H](Nc2ccc(N3CCOCC3)cc2)[C@H](C)C1=O |
| InChI | InChI=1S/C17H22N2O2/c1-12-11-16(13(2)17(12)20)18-14-3-5-15(6-4-14)19-7-9-21-10-8-19/h3-6,11,13,16,18H,7-10H2,1-2H3/t13-,16+/m0/s1 |
| InChIKey | DAVHYMMSNSQUHT-XJKSGUPXSA-N |
| XLogP | 2.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|