C26H26N2O2 — CID 53245425
N-(4-phenylbutyl)-3-(3-phenylprop-2-enoylamino)benzamide (PubChem CID 53245425) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-(4-phenylbutyl)-3-(3-phenylprop-2-enoylamino)benzamide.
| Compound Name | N-(4-phenylbutyl)-3-(3-phenylprop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 53245425 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-(4-phenylbutyl)-3-(3-phenylprop-2-enoylamino)benzamide |
| SMILES | O=C(C=Cc1ccccc1)Nc1cccc(C(=O)NCCCCc2ccccc2)c1 |
| InChI | InChI=1S/C26H26N2O2/c29-25(18-17-22-12-5-2-6-13-22)28-24-16-9-15-23(20-24)26(30)27-19-8-7-14-21-10-3-1-4-11-21/h1-6,9-13,15-18,20H,7-8,14,19H2,(H,27,30)(H,28,29) |
| InChIKey | ABWXGORUIVLWKM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|