C29H33N5O3 — CID 53246571
N-ethyl-3-[4-[6-(2-methoxyethoxy)-3-(1-methylpyrazol-4-yl)-9H-pyrido[3,4-b]indol-5-yl]phenoxy]propan-1-amine (PubChem CID 53246571) has the molecular formula C29H33N5O3 and a molecular weight of 499.62 g/mol. Its IUPAC name is N-ethyl-3-[4-[6-(2-methoxyethoxy)-3-(1-methylpyrazol-4-yl)-9H-pyrido[3,4-b]indol-5-yl]phenoxy]propan-1-amine.
| Compound Name | N-ethyl-3-[4-[6-(2-methoxyethoxy)-3-(1-methylpyrazol-4-yl)-9H-pyrido[3,4-b]indol-5-yl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 53246571 |
| Molecular Formula | C29H33N5O3 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | N-ethyl-3-[4-[6-(2-methoxyethoxy)-3-(1-methylpyrazol-4-yl)-9H-pyrido[3,4-b]indol-5-yl]phenoxy]propan-1-amine |
| SMILES | CCNCCCOc1ccc(-c2c(OCCOC)ccc3[nH]c4cnc(-c5cnn(C)c5)cc4c23)cc1 |
| InChI | InChI=1S/C29H33N5O3/c1-4-30-12-5-13-36-22-8-6-20(7-9-22)28-27(37-15-14-35-3)11-10-24-29(28)23-16-25(31-18-26(23)33-24)21-17-32-34(2)19-21/h6-11,16-19,30,33H,4-5,12-15H2,1-3H3 |
| InChIKey | BTPXGPUYEBNWKG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|