C18H14N6 — CID 53247380
4-(1-methylpyrazol-4-yl)-12-phenyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 53247380) has the molecular formula C18H14N6 and a molecular weight of 314.35 g/mol. Its IUPAC name is 4-(1-methylpyrazol-4-yl)-12-phenyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 4-(1-methylpyrazol-4-yl)-12-phenyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 53247380 |
| Molecular Formula | C18H14N6 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-(1-methylpyrazol-4-yl)-12-phenyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | Cn1cc(-c2cc3c(ncc4cnc(-c5ccccc5)n43)[nH]2)cn1 |
| InChI | InChI=1S/C18H14N6/c1-23-11-13(8-21-23)15-7-16-17(22-15)19-9-14-10-20-18(24(14)16)12-5-3-2-4-6-12/h2-11,22H,1H3 |
| InChIKey | WXKGJZLCSGFOCY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 63.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |