C16H21NO5 — CID 53247850
benzyl N-[[(4R,5S)-2,2-dimethyl-5-[(2R)-oxiran-2-yl]-1,3-dioxolan-4-yl]methyl]carbamate (PubChem CID 53247850) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is benzyl N-[[(4R,5S)-2,2-dimethyl-5-[(2R)-oxiran-2-yl]-1,3-dioxolan-4-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(4R,5S)-2,2-dimethyl-5-[(2R)-oxiran-2-yl]-1,3-dioxolan-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 53247850 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | benzyl N-[[(4R,5S)-2,2-dimethyl-5-[(2R)-oxiran-2-yl]-1,3-dioxolan-4-yl]methyl]carbamate |
| SMILES | CC1(C)O[C@H]([C@H]2CO2)[C@@H](CNC(=O)OCc2ccccc2)O1 |
| InChI | InChI=1S/C16H21NO5/c1-16(2)21-12(14(22-16)13-10-19-13)8-17-15(18)20-9-11-6-4-3-5-7-11/h3-7,12-14H,8-10H2,1-2H3,(H,17,18)/t12-,13-,14+/m1/s1 |
| InChIKey | JETANXIFHOZSBA-MCIONIFRSA-N |
| XLogP | 1.83 |
| TPSA | 69.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|