C17H24N2OS — CID 53248093
(2R,3S)-3-hydroxy-2-methyl-N,N-bis(prop-2-enyl)-5-pyridin-2-ylpentanethioamide (PubChem CID 53248093) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-2-methyl-N,N-bis(prop-2-enyl)-5-pyridin-2-ylpentanethioamide.
| Compound Name | (2R,3S)-3-hydroxy-2-methyl-N,N-bis(prop-2-enyl)-5-pyridin-2-ylpentanethioamide |
|---|---|
| PubChem CID | 53248093 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (2R,3S)-3-hydroxy-2-methyl-N,N-bis(prop-2-enyl)-5-pyridin-2-ylpentanethioamide |
| SMILES | C=CCN(CC=C)C(=S)[C@H](C)[C@@H](O)CCc1ccccn1 |
| InChI | InChI=1S/C17H24N2OS/c1-4-12-19(13-5-2)17(21)14(3)16(20)10-9-15-8-6-7-11-18-15/h4-8,11,14,16,20H,1-2,9-10,12-13H2,3H3/t14-,16+/m1/s1 |
| InChIKey | JYHBABZLARMKRU-ZBFHGGJFSA-N |
| XLogP | 3.01 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|