About 3-tert-butyl-5-phenyl-1,2,4-thiazaphosphole
3-tert-butyl-5-phenyl-1,2,4-thiazaphosphole (PubChem CID 5325069) has the molecular formula C12H14NPS
and a molecular weight of 235.29 g/mol. Its IUPAC name is 3-tert-butyl-5-phenyl-1,2,4-thiazaphosphole.
Molecular Properties
| Compound Name | 3-tert-butyl-5-phenyl-1,2,4-thiazaphosphole |
| PubChem CID | 5325069 |
| Molecular Formula | C12H14NPS |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 3-tert-butyl-5-phenyl-1,2,4-thiazaphosphole |
| SMILES | CC(C)(C)c1nsc(-c2ccccc2)p1 |
| InChI | InChI=1S/C12H14NPS/c1-12(2,3)11-13-15-10(14-11)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | GXZKWHGFUGFQIS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-5-phenyl-1,2,4-thiazaphosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5-phenyl-1,2,4-thiazaphosphole?
The IUPAC name of 3-tert-butyl-5-phenyl-1,2,4-thiazaphosphole (CID 5325069) is 3-tert-butyl-5-phenyl-1,2,4-thiazaphosphole.
What is the SMILES notation for 3-tert-butyl-5-phenyl-1,2,4-thiazaphosphole?
The canonical SMILES for 3-tert-butyl-5-phenyl-1,2,4-thiazaphosphole is CC(C)(C)c1nsc(-c2ccccc2)p1.
What is the InChIKey of 3-tert-butyl-5-phenyl-1,2,4-thiazaphosphole?
The InChIKey is GXZKWHGFUGFQIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14NPS/c1-12(2,3)11-13-15-10(14-11)9-7-5-4-6-8-9/h4-8H,1-3H3.
What are the key properties of 3-tert-butyl-5-phenyl-1,2,4-thiazaphosphole?
3-tert-butyl-5-phenyl-1,2,4-thiazaphosphole has a molecular weight of 235.29 g/mol, XLogP of 4.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5-phenyl-1,2,4-thiazaphosphole is sourced from PubChem (CID 5325069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).