C12H14NPS — CID 5325068
5-tert-butyl-3-phenyl-1,2,4-thiazaphosphole (PubChem CID 5325068) has the molecular formula C12H14NPS and a molecular weight of 235.29 g/mol. Its IUPAC name is 5-tert-butyl-3-phenyl-1,2,4-thiazaphosphole.
| Compound Name | 5-tert-butyl-3-phenyl-1,2,4-thiazaphosphole |
|---|---|
| PubChem CID | 5325068 |
| Molecular Formula | C12H14NPS |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 5-tert-butyl-3-phenyl-1,2,4-thiazaphosphole |
| SMILES | CC(C)(C)c1pc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C12H14NPS/c1-12(2,3)11-14-10(13-15-11)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | SWDWITYLSULZNE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |