C12H15N2P — CID 15961913
3-tert-butyl-5-phenyl-4H-1,2,4-diazaphosphole (PubChem CID 15961913) has the molecular formula C12H15N2P and a molecular weight of 218.24 g/mol. Its IUPAC name is 3-tert-butyl-5-phenyl-4H-1,2,4-diazaphosphole.
| Compound Name | 3-tert-butyl-5-phenyl-4H-1,2,4-diazaphosphole |
|---|---|
| PubChem CID | 15961913 |
| Molecular Formula | C12H15N2P |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 3-tert-butyl-5-phenyl-4H-1,2,4-diazaphosphole |
| SMILES | CC(C)(C)c1nnc(-c2ccccc2)[pH]1 |
| InChI | InChI=1S/C12H15N2P/c1-12(2,3)11-14-13-10(15-11)9-7-5-4-6-8-9/h4-8,15H,1-3H3 |
| InChIKey | HIBPEWSKKOCOKB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |