C9H8N2Se — CID 71482573
2-(4-methylphenyl)-1,3,4-selenadiazole (PubChem CID 71482573) has the molecular formula C9H8N2Se and a molecular weight of 223.14 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1,3,4-selenadiazole.
| Compound Name | 2-(4-methylphenyl)-1,3,4-selenadiazole |
|---|---|
| PubChem CID | 71482573 |
| Molecular Formula | C9H8N2Se |
| Molecular Weight | 223.14 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 2-(4-methylphenyl)-1,3,4-selenadiazole |
| SMILES | Cc1ccc(-c2nnc[se]2)cc1 |
| InChI | InChI=1S/C9H8N2Se/c1-7-2-4-8(5-3-7)9-11-10-6-12-9/h2-6H,1H3 |
| InChIKey | QWLIKYAQYAAZGZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.14 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|