C9H5F3N2Se — CID 71482574
2-[4-(trifluoromethyl)phenyl]-1,3,4-selenadiazole (PubChem CID 71482574) has the molecular formula C9H5F3N2Se and a molecular weight of 277.11 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]-1,3,4-selenadiazole.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]-1,3,4-selenadiazole |
|---|---|
| PubChem CID | 71482574 |
| Molecular Formula | C9H5F3N2Se |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 277.96 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]-1,3,4-selenadiazole |
| SMILES | FC(F)(F)c1ccc(-c2nnc[se]2)cc1 |
| InChI | InChI=1S/C9H5F3N2Se/c10-9(11,12)7-3-1-6(2-4-7)8-14-13-5-15-8/h1-5H |
| InChIKey | XOIXKNHEJODBLH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|