C14H10N2Se — CID 71482715
2-(4-phenylphenyl)-1,3,4-selenadiazole (PubChem CID 71482715) has the molecular formula C14H10N2Se and a molecular weight of 285.21 g/mol. Its IUPAC name is 2-(4-phenylphenyl)-1,3,4-selenadiazole.
| Compound Name | 2-(4-phenylphenyl)-1,3,4-selenadiazole |
|---|---|
| PubChem CID | 71482715 |
| Molecular Formula | C14H10N2Se |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 2-(4-phenylphenyl)-1,3,4-selenadiazole |
| SMILES | c1ccc(-c2ccc(-c3nnc[se]3)cc2)cc1 |
| InChI | InChI=1S/C14H10N2Se/c1-2-4-11(5-3-1)12-6-8-13(9-7-12)14-16-15-10-17-14/h1-10H |
| InChIKey | XZDAZEMAMZQYSN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|