C16H15N3Se — CID 166447283
5-[4-(2-phenylethyl)phenyl]-1,3,4-selenadiazol-2-amine (PubChem CID 166447283) has the molecular formula C16H15N3Se and a molecular weight of 328.28 g/mol. Its IUPAC name is 5-[4-(2-phenylethyl)phenyl]-1,3,4-selenadiazol-2-amine.
| Compound Name | 5-[4-(2-phenylethyl)phenyl]-1,3,4-selenadiazol-2-amine |
|---|---|
| PubChem CID | 166447283 |
| Molecular Formula | C16H15N3Se |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 5-[4-(2-phenylethyl)phenyl]-1,3,4-selenadiazol-2-amine |
| SMILES | Nc1nnc(-c2ccc(CCc3ccccc3)cc2)[se]1 |
| InChI | InChI=1S/C16H15N3Se/c17-16-19-18-15(20-16)14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-5,8-11H,6-7H2,(H2,17,19) |
| InChIKey | DNOZHUNHAVWUTJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|