C9H9N3Se — CID 166447202
5-(2-methylphenyl)-1,3,4-selenadiazol-2-amine (PubChem CID 166447202) has the molecular formula C9H9N3Se and a molecular weight of 238.15 g/mol. Its IUPAC name is 5-(2-methylphenyl)-1,3,4-selenadiazol-2-amine.
| Compound Name | 5-(2-methylphenyl)-1,3,4-selenadiazol-2-amine |
|---|---|
| PubChem CID | 166447202 |
| Molecular Formula | C9H9N3Se |
| Molecular Weight | 238.15 g/mol |
| Exact Mass | 239.00 |
| IUPAC Name | 5-(2-methylphenyl)-1,3,4-selenadiazol-2-amine |
| SMILES | Cc1ccccc1-c1nnc(N)[se]1 |
| InChI | InChI=1S/C9H9N3Se/c1-6-4-2-3-5-7(6)8-11-12-9(10)13-8/h2-5H,1H3,(H2,10,12) |
| InChIKey | AVLPXIUPMROJOU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.15 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|