C15H13N2P — CID 86106878
1-methyl-3,5-diphenyl-1,2,4-diazaphosphole (PubChem CID 86106878) has the molecular formula C15H13N2P and a molecular weight of 252.26 g/mol. Its IUPAC name is 1-methyl-3,5-diphenyl-1,2,4-diazaphosphole.
| Compound Name | 1-methyl-3,5-diphenyl-1,2,4-diazaphosphole |
|---|---|
| PubChem CID | 86106878 |
| Molecular Formula | C15H13N2P |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 1-methyl-3,5-diphenyl-1,2,4-diazaphosphole |
| SMILES | Cn1nc(-c2ccccc2)pc1-c1ccccc1 |
| InChI | InChI=1S/C15H13N2P/c1-17-15(13-10-6-3-7-11-13)18-14(16-17)12-8-4-2-5-9-12/h2-11H,1H3 |
| InChIKey | PDWCIPPIYJLIGB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |