C12H16NPSSi — CID 14148103
trimethyl-[3-(4-methylphenyl)-1,2,4-thiazaphosphol-5-yl]silane (PubChem CID 14148103) has the molecular formula C12H16NPSSi and a molecular weight of 265.39 g/mol. Its IUPAC name is trimethyl-[3-(4-methylphenyl)-1,2,4-thiazaphosphol-5-yl]silane.
| Compound Name | trimethyl-[3-(4-methylphenyl)-1,2,4-thiazaphosphol-5-yl]silane |
|---|---|
| PubChem CID | 14148103 |
| Molecular Formula | C12H16NPSSi |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | trimethyl-[3-(4-methylphenyl)-1,2,4-thiazaphosphol-5-yl]silane |
| SMILES | Cc1ccc(-c2nsc([Si](C)(C)C)p2)cc1 |
| InChI | InChI=1S/C12H16NPSSi/c1-9-5-7-10(8-6-9)11-13-15-12(14-11)16(2,3)4/h5-8H,1-4H3 |
| InChIKey | GFSYYSYPKVWUJR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|