C15H12NPS — CID 14148105
3-(4-methylphenyl)-5-phenyl-1,2,4-thiazaphosphole (PubChem CID 14148105) has the molecular formula C15H12NPS and a molecular weight of 269.31 g/mol. Its IUPAC name is 3-(4-methylphenyl)-5-phenyl-1,2,4-thiazaphosphole.
| Compound Name | 3-(4-methylphenyl)-5-phenyl-1,2,4-thiazaphosphole |
|---|---|
| PubChem CID | 14148105 |
| Molecular Formula | C15H12NPS |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 3-(4-methylphenyl)-5-phenyl-1,2,4-thiazaphosphole |
| SMILES | Cc1ccc(-c2nsc(-c3ccccc3)p2)cc1 |
| InChI | InChI=1S/C15H12NPS/c1-11-7-9-12(10-8-11)14-16-18-15(17-14)13-5-3-2-4-6-13/h2-10H,1H3 |
| InChIKey | ZHSKJUVVMWCUHF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |