C14H10NPS — CID 13383241
2,5-diphenyl-1,3,4-thiazaphosphole (PubChem CID 13383241) has the molecular formula C14H10NPS and a molecular weight of 255.28 g/mol. Its IUPAC name is 2,5-diphenyl-1,3,4-thiazaphosphole.
| Compound Name | 2,5-diphenyl-1,3,4-thiazaphosphole |
|---|---|
| PubChem CID | 13383241 |
| Molecular Formula | C14H10NPS |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2,5-diphenyl-1,3,4-thiazaphosphole |
| SMILES | c1ccc(-c2npc(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C14H10NPS/c1-3-7-11(8-4-1)13-15-16-14(17-13)12-9-5-2-6-10-12/h1-10H |
| InChIKey | HHQLXWHXNCNLSB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |