C14H9FN2S — CID 139674306
2-(2-fluorophenyl)-5-phenyl-1,3,4-thiadiazole (PubChem CID 139674306) has the molecular formula C14H9FN2S and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-5-phenyl-1,3,4-thiadiazole.
| Compound Name | 2-(2-fluorophenyl)-5-phenyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 139674306 |
| Molecular Formula | C14H9FN2S |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-(2-fluorophenyl)-5-phenyl-1,3,4-thiadiazole |
| SMILES | Fc1ccccc1-c1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C14H9FN2S/c15-12-9-5-4-8-11(12)14-17-16-13(18-14)10-6-2-1-3-7-10/h1-9H |
| InChIKey | FCJQEOTWYFFVBR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |