C11H14NPSSi — CID 14148101
trimethyl-(3-phenyl-1,2,4-thiazaphosphol-5-yl)silane (PubChem CID 14148101) has the molecular formula C11H14NPSSi and a molecular weight of 251.37 g/mol. Its IUPAC name is trimethyl-(3-phenyl-1,2,4-thiazaphosphol-5-yl)silane.
| Compound Name | trimethyl-(3-phenyl-1,2,4-thiazaphosphol-5-yl)silane |
|---|---|
| PubChem CID | 14148101 |
| Molecular Formula | C11H14NPSSi |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | trimethyl-(3-phenyl-1,2,4-thiazaphosphol-5-yl)silane |
| SMILES | C[Si](C)(C)c1pc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C11H14NPSSi/c1-15(2,3)11-13-10(12-14-11)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | CKDZMVATWUKMEU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|