C21H19N3 — CID 53251102
5-(2-pyridin-3-ylethynyl)-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4,6,8-tetraene (PubChem CID 53251102) has the molecular formula C21H19N3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 5-(2-pyridin-3-ylethynyl)-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4,6,8-tetraene.
| Compound Name | 5-(2-pyridin-3-ylethynyl)-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4,6,8-tetraene |
|---|---|
| PubChem CID | 53251102 |
| Molecular Formula | C21H19N3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 5-(2-pyridin-3-ylethynyl)-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4,6,8-tetraene |
| SMILES | C(#Cc1cccc2c3c([nH]c12)C1CCN(CC1)C3)c1cccnc1 |
| InChI | InChI=1S/C21H19N3/c1-4-16(7-6-15-3-2-10-22-13-15)20-18(5-1)19-14-24-11-8-17(9-12-24)21(19)23-20/h1-5,10,13,17,23H,8-9,11-12,14H2 |
| InChIKey | YZLNTDYPYDQWPJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|