C37H18N6 — CID 11497616
2-[6,9-bis(2-pyridin-3-ylethynyl)-1H-phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile (PubChem CID 11497616) has the molecular formula C37H18N6 and a molecular weight of 546.59 g/mol. Its IUPAC name is 2-[6,9-bis(2-pyridin-3-ylethynyl)-1H-phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 2-[6,9-bis(2-pyridin-3-ylethynyl)-1H-phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 11497616 |
| Molecular Formula | C37H18N6 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | 2-[6,9-bis(2-pyridin-3-ylethynyl)-1H-phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cccc(C#N)c1-c1nc2c3ccc(C#Cc4cccnc4)cc3c3cc(C#Cc4cccnc4)ccc3c2[nH]1 |
| InChI | InChI=1S/C37H18N6/c38-20-28-6-1-7-29(21-39)34(28)37-42-35-30-14-12-24(8-10-26-4-2-16-40-22-26)18-32(30)33-19-25(13-15-31(33)36(35)43-37)9-11-27-5-3-17-41-23-27/h1-7,12-19,22-23H,(H,42,43) |
| InChIKey | GJENJEWIAYJPEA-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|