C29H23BrN4O — CID 24827014
2-[6-bromo-9-(2-ethyl-2-hydroxybutyl)-1H-phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile (PubChem CID 24827014) has the molecular formula C29H23BrN4O and a molecular weight of 523.43 g/mol. Its IUPAC name is 2-[6-bromo-9-(2-ethyl-2-hydroxybutyl)-1H-phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 2-[6-bromo-9-(2-ethyl-2-hydroxybutyl)-1H-phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 24827014 |
| Molecular Formula | C29H23BrN4O |
| Molecular Weight | 523.43 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | 2-[6-bromo-9-(2-ethyl-2-hydroxybutyl)-1H-phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile |
| SMILES | CCC(O)(CC)Cc1ccc2c(c1)c1cc(Br)ccc1c1nc(-c3c(C#N)cccc3C#N)[nH]c21 |
| InChI | InChI=1S/C29H23BrN4O/c1-3-29(35,4-2)14-17-8-10-21-23(12-17)24-13-20(30)9-11-22(24)27-26(21)33-28(34-27)25-18(15-31)6-5-7-19(25)16-32/h5-13,35H,3-4,14H2,1-2H3,(H,33,34) |
| InChIKey | YEPSBKPPFCUGLH-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.43 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|