C25H20BrN3 — CID 143047895
2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole;ethane (PubChem CID 143047895) has the molecular formula C25H20BrN3 and a molecular weight of 442.36 g/mol. Its IUPAC name is 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole;ethane.
| Compound Name | 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole;ethane |
|---|---|
| PubChem CID | 143047895 |
| Molecular Formula | C25H20BrN3 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole;ethane |
| SMILES | Brc1ccc2[nH]cc(-c3nc4c5ccccc5c5ccccc5c4[nH]3)c2c1.CC |
| InChI | InChI=1S/C23H14BrN3.C2H6/c24-13-9-10-20-18(11-13)19(12-25-20)23-26-21-16-7-3-1-5-14(16)15-6-2-4-8-17(15)22(21)27-23;1-2/h1-12,25H,(H,26,27);1-2H3 |
| InChIKey | ZDBXDWMGINWCIQ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|