C25H21N5O — CID 143655539
methylhydrazine;3-(1H-phenanthro[9,10-d]imidazol-2-yl)-1H-indole-6-carbaldehyde (PubChem CID 143655539) has the molecular formula C25H21N5O and a molecular weight of 407.48 g/mol. Its IUPAC name is methylhydrazine;3-(1H-phenanthro[9,10-d]imidazol-2-yl)-1H-indole-6-carbaldehyde.
| Compound Name | methylhydrazine;3-(1H-phenanthro[9,10-d]imidazol-2-yl)-1H-indole-6-carbaldehyde |
|---|---|
| PubChem CID | 143655539 |
| Molecular Formula | C25H21N5O |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | methylhydrazine;3-(1H-phenanthro[9,10-d]imidazol-2-yl)-1H-indole-6-carbaldehyde |
| SMILES | CNN.O=Cc1ccc2c(-c3nc4c5ccccc5c5ccccc5c4[nH]3)c[nH]c2c1 |
| InChI | InChI=1S/C24H15N3O.CH6N2/c28-13-14-9-10-17-20(12-25-21(17)11-14)24-26-22-18-7-3-1-5-15(18)16-6-2-4-8-19(16)23(22)27-24;1-3-2/h1-13,25H,(H,26,27);3H,2H2,1H3 |
| InChIKey | UZEBXYSCOPZHLF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|